C26H29FN4O2S — CID 170110199
N-ethyl-6-fluoro-N-[(1S)-3-[(3-methyl-1-benzofuran-2-yl)methylamino]-3-sulfanylcyclohexyl]-1H-benzimidazole-2-carboxamide (PubChem CID 170110199) has the molecular formula C26H29FN4O2S and a molecular weight of 480.61 g/mol. Its IUPAC name is N-ethyl-6-fluoro-N-[(1S)-3-[(3-methyl-1-benzofuran-2-yl)methylamino]-3-sulfanylcyclohexyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | N-ethyl-6-fluoro-N-[(1S)-3-[(3-methyl-1-benzofuran-2-yl)methylamino]-3-sulfanylcyclohexyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 170110199 |
| Molecular Formula | C26H29FN4O2S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-ethyl-6-fluoro-N-[(1S)-3-[(3-methyl-1-benzofuran-2-yl)methylamino]-3-sulfanylcyclohexyl]-1H-benzimidazole-2-carboxamide |
| SMILES | CCN(C(=O)c1nc2ccc(F)cc2[nH]1)[C@H]1CCCC(S)(NCc2oc3ccccc3c2C)C1 |
| InChI | InChI=1S/C26H29FN4O2S/c1-3-31(25(32)24-29-20-11-10-17(27)13-21(20)30-24)18-7-6-12-26(34,14-18)28-15-23-16(2)19-8-4-5-9-22(19)33-23/h4-5,8-11,13,18,28,34H,3,6-7,12,14-15H2,1-2H3,(H,29,30)/t18-,26?/m0/s1 |
| InChIKey | UIMMIHAVTDQTFI-MDYZWHIJSA-N |
| XLogP | 5.58 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|