C16H22N4O — CID 135156790
N-[(1S,3R)-3-aminocyclohexyl]-N-ethyl-1H-benzimidazole-2-carboxamide (PubChem CID 135156790) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[(1S,3R)-3-aminocyclohexyl]-N-ethyl-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[(1S,3R)-3-aminocyclohexyl]-N-ethyl-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 135156790 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N-[(1S,3R)-3-aminocyclohexyl]-N-ethyl-1H-benzimidazole-2-carboxamide |
| SMILES | CCN(C(=O)c1nc2ccccc2[nH]1)[C@H]1CCC[C@@H](N)C1 |
| InChI | InChI=1S/C16H22N4O/c1-2-20(12-7-5-6-11(17)10-12)16(21)15-18-13-8-3-4-9-14(13)19-15/h3-4,8-9,11-12H,2,5-7,10,17H2,1H3,(H,18,19)/t11-,12+/m1/s1 |
| InChIKey | XQCHGCKIQYTKMD-NEPJUHHUSA-N |
| XLogP | 2.29 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |