C23H27BN4O2 — CID 174100463
CID 174100463 (PubChem CID 174100463) has the molecular formula C23H27BN4O2 and a molecular weight of 402.31 g/mol.
| Compound Name | CID 174100463 |
|---|---|
| PubChem CID | 174100463 |
| Molecular Formula | C23H27BN4O2 |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | — |
| SMILES | [B]C(O)(NC1CCCC(N(CC)C(=O)c2nc3ccccc3[nH]2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H27BN4O2/c1-2-28(22(29)21-25-19-13-6-7-14-20(19)26-21)18-12-8-11-17(15-18)27-23(24,30)16-9-4-3-5-10-16/h3-7,9-10,13-14,17-18,27,30H,2,8,11-12,15H2,1H3,(H,25,26) |
| InChIKey | FPWVQWXOLRBSTB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|