C16H21N7O — CID 135170863
N-[(1S,3R)-3-aminocyclohexyl]-6-azido-N-ethyl-1H-benzimidazole-2-carboxamide (PubChem CID 135170863) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is N-[(1S,3R)-3-aminocyclohexyl]-6-azido-N-ethyl-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[(1S,3R)-3-aminocyclohexyl]-6-azido-N-ethyl-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 135170863 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(1S,3R)-3-aminocyclohexyl]-6-azido-N-ethyl-1H-benzimidazole-2-carboxamide |
| SMILES | CCN(C(=O)c1nc2ccc(N=[N+]=[N-])cc2[nH]1)[C@H]1CCC[C@@H](N)C1 |
| InChI | InChI=1S/C16H21N7O/c1-2-23(12-5-3-4-10(17)8-12)16(24)15-19-13-7-6-11(21-22-18)9-14(13)20-15/h6-7,9-10,12H,2-5,8,17H2,1H3,(H,19,20)/t10-,12+/m1/s1 |
| InChIKey | DJPUXSMPKMSABL-PWSUYJOCSA-N |
| XLogP | 3.24 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|