C26H27N5O2 — CID 155602429
N-[(1S,3R)-3-(1-benzofuran-2-ylmethylamino)cyclohexyl]-N-ethyl-6-isocyano-1H-benzimidazole-2-carboxamide (PubChem CID 155602429) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is N-[(1S,3R)-3-(1-benzofuran-2-ylmethylamino)cyclohexyl]-N-ethyl-6-isocyano-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[(1S,3R)-3-(1-benzofuran-2-ylmethylamino)cyclohexyl]-N-ethyl-6-isocyano-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 155602429 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-[(1S,3R)-3-(1-benzofuran-2-ylmethylamino)cyclohexyl]-N-ethyl-6-isocyano-1H-benzimidazole-2-carboxamide |
| SMILES | [C-]#[N+]c1ccc2nc(C(=O)N(CC)[C@H]3CCC[C@@H](NCc4cc5ccccc5o4)C3)[nH]c2c1 |
| InChI | InChI=1S/C26H27N5O2/c1-3-31(26(32)25-29-22-12-11-18(27-2)15-23(22)30-25)20-9-6-8-19(14-20)28-16-21-13-17-7-4-5-10-24(17)33-21/h4-5,7,10-13,15,19-20,28H,3,6,8-9,14,16H2,1H3,(H,29,30)/t19-,20+/m1/s1 |
| InChIKey | VSODCMXWJASUTG-UXHICEINSA-N |
| XLogP | 5.42 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|