C26H29N5O4 — CID 170110901
N-ethyl-6-nitro-N-[3-[(4-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide (PubChem CID 170110901) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-ethyl-6-nitro-N-[3-[(4-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | N-ethyl-6-nitro-N-[3-[(4-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 170110901 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N-ethyl-6-nitro-N-[3-[(4-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide |
| SMILES | C#CCOc1ccc(CNC2CCCC(N(CC)C(=O)c3nc4ccc([N+](=O)[O-])cc4[nH]3)C2)cc1 |
| InChI | InChI=1S/C26H29N5O4/c1-3-14-35-22-11-8-18(9-12-22)17-27-19-6-5-7-20(15-19)30(4-2)26(32)25-28-23-13-10-21(31(33)34)16-24(23)29-25/h1,8-13,16,19-20,27H,4-7,14-15,17H2,2H3,(H,28,29) |
| InChIKey | KAPXQQYDTKKYGA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|