C26H31N5O2 — CID 135156911
6-amino-N-ethyl-N-[(1S,3R)-3-[(4-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide (PubChem CID 135156911) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 6-amino-N-ethyl-N-[(1S,3R)-3-[(4-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | 6-amino-N-ethyl-N-[(1S,3R)-3-[(4-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 135156911 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 6-amino-N-ethyl-N-[(1S,3R)-3-[(4-prop-2-ynoxyphenyl)methylamino]cyclohexyl]-1H-benzimidazole-2-carboxamide |
| SMILES | C#CCOc1ccc(CN[C@@H]2CCC[C@H](N(CC)C(=O)c3nc4ccc(N)cc4[nH]3)C2)cc1 |
| InChI | InChI=1S/C26H31N5O2/c1-3-14-33-22-11-8-18(9-12-22)17-28-20-6-5-7-21(16-20)31(4-2)26(32)25-29-23-13-10-19(27)15-24(23)30-25/h1,8-13,15,20-21,28H,4-7,14,16-17,27H2,2H3,(H,29,30)/t20-,21+/m1/s1 |
| InChIKey | VDDPQHHPZZFTIS-RTWAWAEBSA-N |
| XLogP | 3.72 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|