C27H28N4O2 — CID 135171332
N-[3-(1-benzofuran-2-ylmethylamino)cyclohexyl]-5-cyano-N-ethyl-1H-indole-2-carboxamide (PubChem CID 135171332) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-[3-(1-benzofuran-2-ylmethylamino)cyclohexyl]-5-cyano-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | N-[3-(1-benzofuran-2-ylmethylamino)cyclohexyl]-5-cyano-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135171332 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N-[3-(1-benzofuran-2-ylmethylamino)cyclohexyl]-5-cyano-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2cc(C#N)ccc2[nH]1)C1CCCC(NCc2cc3ccccc3o2)C1 |
| InChI | InChI=1S/C27H28N4O2/c1-2-31(27(32)25-14-20-12-18(16-28)10-11-24(20)30-25)22-8-5-7-21(15-22)29-17-23-13-19-6-3-4-9-26(19)33-23/h3-4,6,9-14,21-22,29-30H,2,5,7-8,15,17H2,1H3 |
| InChIKey | WSIXORKVQDILGS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |