C24H29FN4OS — CID 170111487
N-ethyl-N-[(3S)-3-[(3-fluorophenyl)methylamino]-3-sulfanylcyclohexyl]-6-methyl-1H-benzimidazole-2-carboxamide (PubChem CID 170111487) has the molecular formula C24H29FN4OS and a molecular weight of 440.59 g/mol. Its IUPAC name is N-ethyl-N-[(3S)-3-[(3-fluorophenyl)methylamino]-3-sulfanylcyclohexyl]-6-methyl-1H-benzimidazole-2-carboxamide.
| Compound Name | N-ethyl-N-[(3S)-3-[(3-fluorophenyl)methylamino]-3-sulfanylcyclohexyl]-6-methyl-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 170111487 |
| Molecular Formula | C24H29FN4OS |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-ethyl-N-[(3S)-3-[(3-fluorophenyl)methylamino]-3-sulfanylcyclohexyl]-6-methyl-1H-benzimidazole-2-carboxamide |
| SMILES | CCN(C(=O)c1nc2ccc(C)cc2[nH]1)C1CCC[C@@](S)(NCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C24H29FN4OS/c1-3-29(23(30)22-27-20-10-9-16(2)12-21(20)28-22)19-8-5-11-24(31,14-19)26-15-17-6-4-7-18(25)13-17/h4,6-7,9-10,12-13,19,26,31H,3,5,8,11,14-15H2,1-2H3,(H,27,28)/t19?,24-/m0/s1 |
| InChIKey | IUXBHKFMXBAUCM-WIIYFNMSSA-N |
| XLogP | 4.83 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|