C19H36O6S — CID 170114832
2-[2-(methoxysulfonylmethyl)pentoxy]ethyl 1-(2,2-dimethylpropyl)-2-methylcyclopropane-1-carboxylate (PubChem CID 170114832) has the molecular formula C19H36O6S and a molecular weight of 392.56 g/mol. Its IUPAC name is 2-[2-(methoxysulfonylmethyl)pentoxy]ethyl 1-(2,2-dimethylpropyl)-2-methylcyclopropane-1-carboxylate.
| Compound Name | 2-[2-(methoxysulfonylmethyl)pentoxy]ethyl 1-(2,2-dimethylpropyl)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 170114832 |
| Molecular Formula | C19H36O6S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[2-(methoxysulfonylmethyl)pentoxy]ethyl 1-(2,2-dimethylpropyl)-2-methylcyclopropane-1-carboxylate |
| SMILES | CCCC(COCCOC(=O)C1(CC(C)(C)C)CC1C)CS(=O)(=O)OC |
| InChI | InChI=1S/C19H36O6S/c1-7-8-16(13-26(21,22)23-6)12-24-9-10-25-17(20)19(11-15(19)2)14-18(3,4)5/h15-16H,7-14H2,1-6H3 |
| InChIKey | ZZUATSYSGKVPPO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|