C12H27NO3S — CID 66227328
2-(3,3-dimethylbutoxymethyl)pentane-1-sulfonamide (PubChem CID 66227328) has the molecular formula C12H27NO3S and a molecular weight of 265.42 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxymethyl)pentane-1-sulfonamide.
| Compound Name | 2-(3,3-dimethylbutoxymethyl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 66227328 |
| Molecular Formula | C12H27NO3S |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2-(3,3-dimethylbutoxymethyl)pentane-1-sulfonamide |
| SMILES | CCCC(COCCC(C)(C)C)CS(N)(=O)=O |
| InChI | InChI=1S/C12H27NO3S/c1-5-6-11(10-17(13,14)15)9-16-8-7-12(2,3)4/h11H,5-10H2,1-4H3,(H2,13,14,15) |
| InChIKey | DOFNZFLMWMRIKY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|