C18H38O — CID 169317578
4-(3,3-dimethylbutoxymethyl)-2,2,6,6-tetramethylheptane (PubChem CID 169317578) has the molecular formula C18H38O and a molecular weight of 270.50 g/mol. Its IUPAC name is 4-(3,3-dimethylbutoxymethyl)-2,2,6,6-tetramethylheptane.
| Compound Name | 4-(3,3-dimethylbutoxymethyl)-2,2,6,6-tetramethylheptane |
|---|---|
| PubChem CID | 169317578 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | 4-(3,3-dimethylbutoxymethyl)-2,2,6,6-tetramethylheptane |
| SMILES | CC(C)(C)CCOCC(CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C18H38O/c1-16(2,3)10-11-19-14-15(12-17(4,5)6)13-18(7,8)9/h15H,10-14H2,1-9H3 |
| InChIKey | PWTNIUHIAJQCMU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|