About 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine
1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine (PubChem CID 66234263) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine |
| PubChem CID | 66234263 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine |
| SMILES | CCNC(COCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-8-15-12(14(5,6)7)11-16-10-9-13(2,3)4/h12,15H,8-11H2,1-7H3 |
| InChIKey | KDSGZNBHNHAOOO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine?
The IUPAC name of 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine (CID 66234263) is 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine.
What is the SMILES notation for 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine?
The canonical SMILES for 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine is CCNC(COCCC(C)(C)C)C(C)(C)C.
What is the InChIKey of 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine?
The InChIKey is KDSGZNBHNHAOOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NO/c1-8-15-12(14(5,6)7)11-16-10-9-13(2,3)4/h12,15H,8-11H2,1-7H3.
What are the key properties of 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine?
1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine has a molecular weight of 229.41 g/mol, XLogP of 3.46, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine is sourced from PubChem (CID 66234263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).