C14H31NO — CID 66234263
1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine (PubChem CID 66234263) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine.
| Compound Name | 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 66234263 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 1-(3,3-dimethylbutoxy)-N-ethyl-3,3-dimethylbutan-2-amine |
| SMILES | CCNC(COCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-8-15-12(14(5,6)7)11-16-10-9-13(2,3)4/h12,15H,8-11H2,1-7H3 |
| InChIKey | KDSGZNBHNHAOOO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|