C16H35NO — CID 55192880
N-ethyl-1-(2-ethylhexoxy)-3,3-dimethylbutan-2-amine (PubChem CID 55192880) has the molecular formula C16H35NO and a molecular weight of 257.46 g/mol. Its IUPAC name is N-ethyl-1-(2-ethylhexoxy)-3,3-dimethylbutan-2-amine.
| Compound Name | N-ethyl-1-(2-ethylhexoxy)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 55192880 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | N-ethyl-1-(2-ethylhexoxy)-3,3-dimethylbutan-2-amine |
| SMILES | CCCCC(CC)COCC(NCC)C(C)(C)C |
| InChI | InChI=1S/C16H35NO/c1-7-10-11-14(8-2)12-18-13-15(17-9-3)16(4,5)6/h14-15,17H,7-13H2,1-6H3 |
| InChIKey | OMRMNHWUQSZGEH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |