C17H20ClN5O4 — CID 170117884
ethyl (2S,3S)-3-[(2-chloro-7-nitropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 170117884) has the molecular formula C17H20ClN5O4 and a molecular weight of 393.83 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[(2-chloro-7-nitropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]bicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[(2-chloro-7-nitropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]bicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 170117884 |
| Molecular Formula | C17H20ClN5O4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | ethyl (2S,3S)-3-[(2-chloro-7-nitropyrrolo[2,1-f][1,2,4]triazin-4-yl)amino]bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C2CCC(CC2)[C@@H]1Nc1nc(Cl)nn2c([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C17H20ClN5O4/c1-2-27-16(24)13-9-3-5-10(6-4-9)14(13)19-15-11-7-8-12(23(25)26)22(11)21-17(18)20-15/h7-10,13-14H,2-6H2,1H3,(H,19,20,21)/t9?,10?,13-,14-/m0/s1 |
| InChIKey | TZQXWFZJRDRMTE-FMPDERDJSA-N |
| XLogP | 3.07 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|