C20H25ClN4O3 — CID 162434542
ethyl (1R,6S,7S,8S)-8-[[2-chloro-7-(hydroxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[4.2.2.02,5]decane-7-carboxylate (PubChem CID 162434542) has the molecular formula C20H25ClN4O3 and a molecular weight of 404.90 g/mol. Its IUPAC name is ethyl (1R,6S,7S,8S)-8-[[2-chloro-7-(hydroxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[4.2.2.02,5]decane-7-carboxylate.
| Compound Name | ethyl (1R,6S,7S,8S)-8-[[2-chloro-7-(hydroxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[4.2.2.02,5]decane-7-carboxylate |
|---|---|
| PubChem CID | 162434542 |
| Molecular Formula | C20H25ClN4O3 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | ethyl (1R,6S,7S,8S)-8-[[2-chloro-7-(hydroxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[4.2.2.02,5]decane-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](Nc2nc(Cl)nn3c(CO)ccc23)[C@@H]2CC[C@H]1C1CCC12 |
| InChI | InChI=1S/C20H25ClN4O3/c1-2-28-19(27)16-13-6-7-14(12-5-4-11(12)13)17(16)22-18-15-8-3-10(9-26)25(15)24-20(21)23-18/h3,8,11-14,16-17,26H,2,4-7,9H2,1H3,(H,22,23,24)/t11?,12?,13-,14+,16-,17-/m0/s1 |
| InChIKey | JNSGQDMYKXYYJW-IHQRNOLKSA-N |
| XLogP | 2.90 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |