C19H23ClN4O3 — CID 169029146
ethyl (1R,5S,6S,7S)-7-[[2-chloro-7-(hydroxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[3.2.2.02,4]nonane-6-carboxylate (PubChem CID 169029146) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is ethyl (1R,5S,6S,7S)-7-[[2-chloro-7-(hydroxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[3.2.2.02,4]nonane-6-carboxylate.
| Compound Name | ethyl (1R,5S,6S,7S)-7-[[2-chloro-7-(hydroxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[3.2.2.02,4]nonane-6-carboxylate |
|---|---|
| PubChem CID | 169029146 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | ethyl (1R,5S,6S,7S)-7-[[2-chloro-7-(hydroxymethyl)pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]tricyclo[3.2.2.02,4]nonane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](Nc2nc(Cl)nn3c(CO)ccc23)[C@@H]2CC[C@H]1C1CC12 |
| InChI | InChI=1S/C19H23ClN4O3/c1-2-27-18(26)15-10-4-5-11(13-7-12(10)13)16(15)21-17-14-6-3-9(8-25)24(14)23-19(20)22-17/h3,6,10-13,15-16,25H,2,4-5,7-8H2,1H3,(H,21,22,23)/t10-,11+,12?,13?,15-,16-/m0/s1 |
| InChIKey | MPJHPRWRRGCQHO-IKJGNNCDSA-N |
| XLogP | 2.51 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |