C13H23F3O4 — CID 170118772
1-[2-(2,2,2-trifluoroethoxy)ethoxy]ethyl 2,4-dimethylpentanoate (PubChem CID 170118772) has the molecular formula C13H23F3O4 and a molecular weight of 300.32 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethoxy)ethoxy]ethyl 2,4-dimethylpentanoate.
| Compound Name | 1-[2-(2,2,2-trifluoroethoxy)ethoxy]ethyl 2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 170118772 |
| Molecular Formula | C13H23F3O4 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-[2-(2,2,2-trifluoroethoxy)ethoxy]ethyl 2,4-dimethylpentanoate |
| SMILES | CC(C)CC(C)C(=O)OC(C)OCCOCC(F)(F)F |
| InChI | InChI=1S/C13H23F3O4/c1-9(2)7-10(3)12(17)20-11(4)19-6-5-18-8-13(14,15)16/h9-11H,5-8H2,1-4H3 |
| InChIKey | WEJVFXBCJZLKQH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|