C27H33N3O4S — CID 17011941
N-[[4-(diethylamino)phenyl]methyl]-5-(3,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)-1,2-oxazole-3-carboxamide (PubChem CID 17011941) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-5-(3,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-5-(3,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 17011941 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-5-(3,4-dimethylphenyl)-N-(1,1-dioxothiolan-3-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCN(CC)c1ccc(CN(C(=O)c2cc(-c3ccc(C)c(C)c3)on2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C27H33N3O4S/c1-5-29(6-2)23-11-8-21(9-12-23)17-30(24-13-14-35(32,33)18-24)27(31)25-16-26(34-28-25)22-10-7-19(3)20(4)15-22/h7-12,15-16,24H,5-6,13-14,17-18H2,1-4H3 |
| InChIKey | JCWQEXPWRZCDOY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|