C25H29N3O4S — CID 42279896
N-[[4-(diethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 42279896) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 42279896 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CCN(CC)c1ccc(CN(C(=O)c2cc(-c3ccccc3)on2)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C25H29N3O4S/c1-3-27(4-2)21-12-10-19(11-13-21)17-28(22-14-15-33(30,31)18-22)25(29)23-16-24(32-26-23)20-8-6-5-7-9-20/h5-13,16,22H,3-4,14-15,17-18H2,1-2H3/t22-/m0/s1 |
| InChIKey | KUWCUWSHCYSFKO-QFIPXVFZSA-N |
| XLogP | 4.02 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|