C26H28N2O5S — CID 41008428
N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(4-methoxyphenyl)methyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 41008428) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(4-methoxyphenyl)methyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(4-methoxyphenyl)methyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 41008428 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(4-methoxyphenyl)methyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | COc1ccc(CN(C(=O)c2cc(-c3ccc4c(c3)CCCC4)on2)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C26H28N2O5S/c1-32-23-10-6-18(7-11-23)16-28(22-12-13-34(30,31)17-22)26(29)24-15-25(33-27-24)21-9-8-19-4-2-3-5-20(19)14-21/h6-11,14-15,22H,2-5,12-13,16-17H2,1H3/t22-/m1/s1 |
| InChIKey | SGBSGQSGKWOMQQ-JOCHJYFZSA-N |
| XLogP | 4.06 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |