C20H34N4O2S — CID 170120413
8-(2,5-dimethylpyrazol-3-yl)sulfanyl-3-[3-(ethoxymethyl)pyrrolidin-1-yl]-1-oxa-8-azaspiro[4.5]decane (PubChem CID 170120413) has the molecular formula C20H34N4O2S and a molecular weight of 394.59 g/mol. Its IUPAC name is 8-(2,5-dimethylpyrazol-3-yl)sulfanyl-3-[3-(ethoxymethyl)pyrrolidin-1-yl]-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(2,5-dimethylpyrazol-3-yl)sulfanyl-3-[3-(ethoxymethyl)pyrrolidin-1-yl]-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 170120413 |
| Molecular Formula | C20H34N4O2S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 8-(2,5-dimethylpyrazol-3-yl)sulfanyl-3-[3-(ethoxymethyl)pyrrolidin-1-yl]-1-oxa-8-azaspiro[4.5]decane |
| SMILES | CCOCC1CCN(C2COC3(CCN(Sc4cc(C)nn4C)CC3)C2)C1 |
| InChI | InChI=1S/C20H34N4O2S/c1-4-25-14-17-5-8-23(13-17)18-12-20(26-15-18)6-9-24(10-7-20)27-19-11-16(2)21-22(19)3/h11,17-18H,4-10,12-15H2,1-3H3 |
| InChIKey | IVEGAKFATZVWME-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|