C16H19N3O5 — CID 170122877
2-methoxyethyl 5-hydroxy-2-morpholin-4-yl-1,7-naphthyridine-6-carboxylate (PubChem CID 170122877) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-methoxyethyl 5-hydroxy-2-morpholin-4-yl-1,7-naphthyridine-6-carboxylate.
| Compound Name | 2-methoxyethyl 5-hydroxy-2-morpholin-4-yl-1,7-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 170122877 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-methoxyethyl 5-hydroxy-2-morpholin-4-yl-1,7-naphthyridine-6-carboxylate |
| SMILES | COCCOC(=O)c1ncc2nc(N3CCOCC3)ccc2c1O |
| InChI | InChI=1S/C16H19N3O5/c1-22-8-9-24-16(21)14-15(20)11-2-3-13(18-12(11)10-17-14)19-4-6-23-7-5-19/h2-3,10,20H,4-9H2,1H3 |
| InChIKey | YQFAKCJUWCPCBE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|