C49H98N2O5 — CID 170124030
N-[3-[3-[[3,3-dimethyl-4-(2,2,4-trimethylheptoxy)butanoyl]amino]-2,2-dimethylpropoxy]-2,2-dimethylpropyl]-2,2-dimethyl-4-(2-methyl-5-pentylundecan-2-yl)oxybutanamide (PubChem CID 170124030) has the molecular formula C49H98N2O5 and a molecular weight of 795.33 g/mol. Its IUPAC name is N-[3-[3-[[3,3-dimethyl-4-(2,2,4-trimethylheptoxy)butanoyl]amino]-2,2-dimethylpropoxy]-2,2-dimethylpropyl]-2,2-dimethyl-4-(2-methyl-5-pentylundecan-2-yl)oxybutanamide.
| Compound Name | N-[3-[3-[[3,3-dimethyl-4-(2,2,4-trimethylheptoxy)butanoyl]amino]-2,2-dimethylpropoxy]-2,2-dimethylpropyl]-2,2-dimethyl-4-(2-methyl-5-pentylundecan-2-yl)oxybutanamide |
|---|---|
| PubChem CID | 170124030 |
| Molecular Formula | C49H98N2O5 |
| Molecular Weight | 795.33 g/mol |
| Exact Mass | 794.75 |
| IUPAC Name | N-[3-[3-[[3,3-dimethyl-4-(2,2,4-trimethylheptoxy)butanoyl]amino]-2,2-dimethylpropoxy]-2,2-dimethylpropyl]-2,2-dimethyl-4-(2-methyl-5-pentylundecan-2-yl)oxybutanamide |
| SMILES | CCCCCCC(CCCCC)CCC(C)(C)OCCC(C)(C)C(=O)NCC(C)(C)COCC(C)(C)CNC(=O)CC(C)(C)COCC(C)(C)CC(C)CCC |
| InChI | InChI=1S/C49H98N2O5/c1-17-20-22-24-27-41(26-23-21-18-2)28-29-49(15,16)56-31-30-48(13,14)43(53)51-35-47(11,12)39-55-38-46(9,10)34-50-42(52)33-45(7,8)37-54-36-44(5,6)32-40(4)25-19-3/h40-41H,17-39H2,1-16H3,(H,50,52)(H,51,53) |
| InChIKey | YBFRHQZZJSBUJW-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.33 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|