C24H25BrIN3O3 — CID 170125195
[1-[3-(4-bromophenyl)propanoyl]-4-[(7-methyl-4-oxoquinazolin-3-yl)methyl]piperidin-4-yl] hypoiodite (PubChem CID 170125195) has the molecular formula C24H25BrIN3O3 and a molecular weight of 610.29 g/mol. Its IUPAC name is [1-[3-(4-bromophenyl)propanoyl]-4-[(7-methyl-4-oxoquinazolin-3-yl)methyl]piperidin-4-yl] hypoiodite.
| Compound Name | [1-[3-(4-bromophenyl)propanoyl]-4-[(7-methyl-4-oxoquinazolin-3-yl)methyl]piperidin-4-yl] hypoiodite |
|---|---|
| PubChem CID | 170125195 |
| Molecular Formula | C24H25BrIN3O3 |
| Molecular Weight | 610.29 g/mol |
| Exact Mass | 609.01 |
| IUPAC Name | [1-[3-(4-bromophenyl)propanoyl]-4-[(7-methyl-4-oxoquinazolin-3-yl)methyl]piperidin-4-yl] hypoiodite |
| SMILES | Cc1ccc2c(=O)n(CC3(OI)CCN(C(=O)CCc4ccc(Br)cc4)CC3)cnc2c1 |
| InChI | InChI=1S/C24H25BrIN3O3/c1-17-2-8-20-21(14-17)27-16-29(23(20)31)15-24(32-26)10-12-28(13-11-24)22(30)9-5-18-3-6-19(25)7-4-18/h2-4,6-8,14,16H,5,9-13,15H2,1H3 |
| InChIKey | ADQJVBFBOOAZGR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|