C27H27F3N6O — CID 170125747
[5,7-diethyl-2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[3-methyl-5-(1,2,4-triazol-4-yl)phenyl]methanone (PubChem CID 170125747) has the molecular formula C27H27F3N6O and a molecular weight of 508.55 g/mol. Its IUPAC name is [5,7-diethyl-2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[3-methyl-5-(1,2,4-triazol-4-yl)phenyl]methanone.
| Compound Name | [5,7-diethyl-2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[3-methyl-5-(1,2,4-triazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 170125747 |
| Molecular Formula | C27H27F3N6O |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | [5,7-diethyl-2-methyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-[3-methyl-5-(1,2,4-triazol-4-yl)phenyl]methanone |
| SMILES | CCC1Cc2c(nn(C)c2-c2cc(F)c(F)c(F)c2)C(CC)N1C(=O)c1cc(C)cc(-n2cnnc2)c1 |
| InChI | InChI=1S/C27H27F3N6O/c1-5-18-12-20-25(33-34(4)26(20)16-10-21(28)24(30)22(29)11-16)23(6-2)36(18)27(37)17-7-15(3)8-19(9-17)35-13-31-32-14-35/h7-11,13-14,18,23H,5-6,12H2,1-4H3 |
| InChIKey | JXVLTGGTGCGXDV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|