C26H26F3N5O — CID 146480859
(2,6-dimethylimidazo[1,2-a]pyridin-3-yl)-[5-ethyl-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone (PubChem CID 146480859) has the molecular formula C26H26F3N5O and a molecular weight of 481.52 g/mol. Its IUPAC name is (2,6-dimethylimidazo[1,2-a]pyridin-3-yl)-[5-ethyl-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone.
| Compound Name | (2,6-dimethylimidazo[1,2-a]pyridin-3-yl)-[5-ethyl-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 146480859 |
| Molecular Formula | C26H26F3N5O |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (2,6-dimethylimidazo[1,2-a]pyridin-3-yl)-[5-ethyl-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
| SMILES | CCC1Cc2c(nn(C)c2-c2cc(F)c(F)c(F)c2)C(C)N1C(=O)c1c(C)nc2ccc(C)cn12 |
| InChI | InChI=1S/C26H26F3N5O/c1-6-17-11-18-23(31-32(5)25(18)16-9-19(27)22(29)20(28)10-16)15(4)34(17)26(35)24-14(3)30-21-8-7-13(2)12-33(21)24/h7-10,12,15,17H,6,11H2,1-5H3 |
| InChIKey | SSYUUKDBRZQHIC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|