C25H24F3N5O — CID 170126381
[5-ethyl-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanone (PubChem CID 170126381) has the molecular formula C25H24F3N5O and a molecular weight of 467.50 g/mol. Its IUPAC name is [5-ethyl-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanone.
| Compound Name | [5-ethyl-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 170126381 |
| Molecular Formula | C25H24F3N5O |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | [5-ethyl-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(2-methylimidazo[1,2-a]pyridin-3-yl)methanone |
| SMILES | CCC1Cc2c(nn(C)c2-c2cc(F)c(F)c(F)c2)C(C)N1C(=O)c1c(C)nc2ccccn12 |
| InChI | InChI=1S/C25H24F3N5O/c1-5-16-12-17-22(30-31(4)24(17)15-10-18(26)21(28)19(27)11-15)14(3)33(16)25(34)23-13(2)29-20-8-6-7-9-32(20)23/h6-11,14,16H,5,12H2,1-4H3 |
| InChIKey | WKERLNYRNNWTCX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|