C25H22F5N5O — CID 146480301
[2-(difluoromethyl)imidazo[1,2-a]pyridin-3-yl]-[7-ethyl-2,5-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone (PubChem CID 146480301) has the molecular formula C25H22F5N5O and a molecular weight of 503.48 g/mol. Its IUPAC name is [2-(difluoromethyl)imidazo[1,2-a]pyridin-3-yl]-[7-ethyl-2,5-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone.
| Compound Name | [2-(difluoromethyl)imidazo[1,2-a]pyridin-3-yl]-[7-ethyl-2,5-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 146480301 |
| Molecular Formula | C25H22F5N5O |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | [2-(difluoromethyl)imidazo[1,2-a]pyridin-3-yl]-[7-ethyl-2,5-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]methanone |
| SMILES | CCC1c2nn(C)c(-c3cc(F)c(F)c(F)c3)c2CC(C)N1C(=O)c1c(C(F)F)nc2ccccn12 |
| InChI | InChI=1S/C25H22F5N5O/c1-4-17-20-14(22(33(3)32-20)13-10-15(26)19(28)16(27)11-13)9-12(2)35(17)25(36)23-21(24(29)30)31-18-7-5-6-8-34(18)23/h5-8,10-12,17,24H,4,9H2,1-3H3 |
| InChIKey | FDYXKACAPCRWGI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|