C19H24FN3O3 — CID 170127436
[[1-tert-butyl-3-[(1S,3S,4R)-3-fluoro-4-hydroxycyclopentyl]pyrazol-5-yl]amino] benzoate (PubChem CID 170127436) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is [[1-tert-butyl-3-[(1S,3S,4R)-3-fluoro-4-hydroxycyclopentyl]pyrazol-5-yl]amino] benzoate.
| Compound Name | [[1-tert-butyl-3-[(1S,3S,4R)-3-fluoro-4-hydroxycyclopentyl]pyrazol-5-yl]amino] benzoate |
|---|---|
| PubChem CID | 170127436 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | [[1-tert-butyl-3-[(1S,3S,4R)-3-fluoro-4-hydroxycyclopentyl]pyrazol-5-yl]amino] benzoate |
| SMILES | CC(C)(C)n1nc([C@H]2C[C@@H](O)[C@@H](F)C2)cc1NOC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24FN3O3/c1-19(2,3)23-17(22-26-18(25)12-7-5-4-6-8-12)11-15(21-23)13-9-14(20)16(24)10-13/h4-8,11,13-14,16,22,24H,9-10H2,1-3H3/t13-,14+,16-/m1/s1 |
| InChIKey | CZVCDPQGRYIOQX-IJEWVQPXSA-N |
| XLogP | 3.40 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|