C29H26FN3O2 — CID 170130094
benzyl 6-cyclohexyl-5-(4-fluorophenyl)pyrrolo[2,3-f]indazole-1-carboxylate (PubChem CID 170130094) has the molecular formula C29H26FN3O2 and a molecular weight of 467.54 g/mol. Its IUPAC name is benzyl 6-cyclohexyl-5-(4-fluorophenyl)pyrrolo[2,3-f]indazole-1-carboxylate.
| Compound Name | benzyl 6-cyclohexyl-5-(4-fluorophenyl)pyrrolo[2,3-f]indazole-1-carboxylate |
|---|---|
| PubChem CID | 170130094 |
| Molecular Formula | C29H26FN3O2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | benzyl 6-cyclohexyl-5-(4-fluorophenyl)pyrrolo[2,3-f]indazole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)n1ncc2cc3c(cc(C4CCCCC4)n3-c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C29H26FN3O2/c30-24-11-13-25(14-12-24)32-26(21-9-5-2-6-10-21)15-22-16-28-23(17-27(22)32)18-31-33(28)29(34)35-19-20-7-3-1-4-8-20/h1,3-4,7-8,11-18,21H,2,5-6,9-10,19H2 |
| InChIKey | QZJNGTQXHRLZBC-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |