C24H16Cl2N2 — CID 170133592
2,9-dichloro-4,7-diphenyl-1,2-dihydro-1,10-phenanthroline (PubChem CID 170133592) has the molecular formula C24H16Cl2N2 and a molecular weight of 403.31 g/mol. Its IUPAC name is 2,9-dichloro-4,7-diphenyl-1,2-dihydro-1,10-phenanthroline.
| Compound Name | 2,9-dichloro-4,7-diphenyl-1,2-dihydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 170133592 |
| Molecular Formula | C24H16Cl2N2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2,9-dichloro-4,7-diphenyl-1,2-dihydro-1,10-phenanthroline |
| SMILES | Clc1cc(-c2ccccc2)c2ccc3c(c2n1)NC(Cl)C=C3c1ccccc1 |
| InChI | InChI=1S/C24H16Cl2N2/c25-21-13-19(15-7-3-1-4-8-15)17-11-12-18-20(16-9-5-2-6-10-16)14-22(26)28-24(18)23(17)27-21/h1-14,21,27H |
| InChIKey | SLXOFUIABXWAEI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|