C22H18ClN2+ — CID 172729714
9-chloro-2-(2-methylpropan-2-yl)-4-phenyl-1,10-phenanthroline (PubChem CID 172729714) has the molecular formula C22H18ClN2+ and a molecular weight of 345.85 g/mol. Its IUPAC name is 9-chloro-2-(2-methylpropan-2-yl)-4-phenyl-1,10-phenanthroline.
| Compound Name | 9-chloro-2-(2-methylpropan-2-yl)-4-phenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 172729714 |
| Molecular Formula | C22H18ClN2+ |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 9-chloro-2-(2-methylpropan-2-yl)-4-phenyl-1,10-phenanthroline |
| SMILES | [CH2+]C(C)(C)c1cc(-c2ccccc2)c2ccc3ccc(Cl)nc3c2n1 |
| InChI | InChI=1S/C22H18ClN2/c1-22(2,3)18-13-17(14-7-5-4-6-8-14)16-11-9-15-10-12-19(23)25-20(15)21(16)24-18/h4-13H,1H2,2-3H3/q+1 |
| InChIKey | HPYXSQWDQCEPOV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|