C54H48N2 — CID 22971987
2,9-bis[2-(2,8-dimethylnaphthalen-1-yl)propan-2-yl]-4,7-diphenyl-1,10-phenanthroline (PubChem CID 22971987) has the molecular formula C54H48N2 and a molecular weight of 724.99 g/mol. Its IUPAC name is 2,9-bis[2-(2,8-dimethylnaphthalen-1-yl)propan-2-yl]-4,7-diphenyl-1,10-phenanthroline.
| Compound Name | 2,9-bis[2-(2,8-dimethylnaphthalen-1-yl)propan-2-yl]-4,7-diphenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 22971987 |
| Molecular Formula | C54H48N2 |
| Molecular Weight | 724.99 g/mol |
| Exact Mass | 724.38 |
| IUPAC Name | 2,9-bis[2-(2,8-dimethylnaphthalen-1-yl)propan-2-yl]-4,7-diphenyl-1,10-phenanthroline |
| SMILES | Cc1ccc2cccc(C)c2c1C(C)(C)c1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)cc(C(C)(C)c4c(C)ccc5cccc(C)c45)nc3c2n1 |
| InChI | InChI=1S/C54H48N2/c1-33-17-15-23-39-27-25-35(3)49(47(33)39)53(5,6)45-31-43(37-19-11-9-12-20-37)41-29-30-42-44(38-21-13-10-14-22-38)32-46(56-52(42)51(41)55-45)54(7,8)50-36(4)26-28-40-24-16-18-34(2)48(40)50/h9-32H,1-8H3 |
| InChIKey | KLUMQXYZDPMIPK-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.99 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|