C17H22O3 — CID 170137479
cyclohex-2-en-1-yl 5-butan-2-yl-2-hydroxybenzoate (PubChem CID 170137479) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is cyclohex-2-en-1-yl 5-butan-2-yl-2-hydroxybenzoate.
| Compound Name | cyclohex-2-en-1-yl 5-butan-2-yl-2-hydroxybenzoate |
|---|---|
| PubChem CID | 170137479 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | cyclohex-2-en-1-yl 5-butan-2-yl-2-hydroxybenzoate |
| SMILES | CCC(C)c1ccc(O)c(C(=O)OC2C=CCCC2)c1 |
| InChI | InChI=1S/C17H22O3/c1-3-12(2)13-9-10-16(18)15(11-13)17(19)20-14-7-5-4-6-8-14/h5,7,9-12,14,18H,3-4,6,8H2,1-2H3 |
| InChIKey | JMYUSIBFVUGUFR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|