About [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol
[1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol (PubChem CID 170142343) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol |
| PubChem CID | 170142343 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol |
| SMILES | C=CC(=C)NCN1CCC(C)(CO)CC1 |
| InChI | InChI=1S/C12H22N2O/c1-4-11(2)13-10-14-7-5-12(3,9-15)6-8-14/h4,13,15H,1-2,5-10H2,3H3 |
| InChIKey | RFECGLUCWJYONR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol?
The IUPAC name of [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol (CID 170142343) is [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol.
What is the SMILES notation for [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol?
The canonical SMILES for [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol is C=CC(=C)NCN1CCC(C)(CO)CC1.
What is the InChIKey of [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol?
The InChIKey is RFECGLUCWJYONR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-4-11(2)13-10-14-7-5-12(3,9-15)6-8-14/h4,13,15H,1-2,5-10H2,3H3.
What are the key properties of [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol?
[1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol has a molecular weight of 210.32 g/mol, XLogP of 1.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(buta-1,3-dien-2-ylamino)methyl]-4-methylpiperidin-4-yl]methanol is sourced from PubChem (CID 170142343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).