C17H25N3O4S — CID 170143969
tert-butyl 4-[(6-ethenyl-2-methyl-3-pyridinyl)sulfonyl]piperazine-1-carboxylate (PubChem CID 170143969) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is tert-butyl 4-[(6-ethenyl-2-methyl-3-pyridinyl)sulfonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-ethenyl-2-methyl-3-pyridinyl)sulfonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170143969 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | tert-butyl 4-[(6-ethenyl-2-methyl-3-pyridinyl)sulfonyl]piperazine-1-carboxylate |
| SMILES | C=Cc1ccc(S(=O)(=O)N2CCN(C(=O)OC(C)(C)C)CC2)c(C)n1 |
| InChI | InChI=1S/C17H25N3O4S/c1-6-14-7-8-15(13(2)18-14)25(22,23)20-11-9-19(10-12-20)16(21)24-17(3,4)5/h6-8H,1,9-12H2,2-5H3 |
| InChIKey | LSTVPTUCZOMZKD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |