C27H53N3O3 — CID 170143996
4-amino-5-tert-butyl-2-(4-formyl-2,3,3,4-tetramethylhexan-2-yl)-3,3,4-trimethyl-N'-propan-2-ylhexanediamide (PubChem CID 170143996) has the molecular formula C27H53N3O3 and a molecular weight of 467.74 g/mol. Its IUPAC name is 4-amino-5-tert-butyl-2-(4-formyl-2,3,3,4-tetramethylhexan-2-yl)-3,3,4-trimethyl-N'-propan-2-ylhexanediamide.
| Compound Name | 4-amino-5-tert-butyl-2-(4-formyl-2,3,3,4-tetramethylhexan-2-yl)-3,3,4-trimethyl-N'-propan-2-ylhexanediamide |
|---|---|
| PubChem CID | 170143996 |
| Molecular Formula | C27H53N3O3 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 467.41 |
| IUPAC Name | 4-amino-5-tert-butyl-2-(4-formyl-2,3,3,4-tetramethylhexan-2-yl)-3,3,4-trimethyl-N'-propan-2-ylhexanediamide |
| SMILES | CCC(C)(C=O)C(C)(C)C(C)(C)C(C(N)=O)C(C)(C)C(C)(N)C(C(=O)NC(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H53N3O3/c1-15-26(13,16-31)25(11,12)23(7,8)18(20(28)32)24(9,10)27(14,29)19(22(4,5)6)21(33)30-17(2)3/h16-19H,15,29H2,1-14H3,(H2,28,32)(H,30,33) |
| InChIKey | JKSDWYNCSSSNFN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|