C20H19F3N6O2 — CID 170146194
4-[[2-amino-6-(trifluoromethyl)-4-pyridinyl]methylamino]-6-(2-methoxyethoxy)-2-methylquinazoline-7-carbonitrile (PubChem CID 170146194) has the molecular formula C20H19F3N6O2 and a molecular weight of 432.41 g/mol. Its IUPAC name is 4-[[2-amino-6-(trifluoromethyl)-4-pyridinyl]methylamino]-6-(2-methoxyethoxy)-2-methylquinazoline-7-carbonitrile.
| Compound Name | 4-[[2-amino-6-(trifluoromethyl)-4-pyridinyl]methylamino]-6-(2-methoxyethoxy)-2-methylquinazoline-7-carbonitrile |
|---|---|
| PubChem CID | 170146194 |
| Molecular Formula | C20H19F3N6O2 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-[[2-amino-6-(trifluoromethyl)-4-pyridinyl]methylamino]-6-(2-methoxyethoxy)-2-methylquinazoline-7-carbonitrile |
| SMILES | COCCOc1cc2c(NCc3cc(N)nc(C(F)(F)F)c3)nc(C)nc2cc1C#N |
| InChI | InChI=1S/C20H19F3N6O2/c1-11-27-15-7-13(9-24)16(31-4-3-30-2)8-14(15)19(28-11)26-10-12-5-17(20(21,22)23)29-18(25)6-12/h5-8H,3-4,10H2,1-2H3,(H2,25,29)(H,26,27,28) |
| InChIKey | ZCVBWEGLIFYBNU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|