C33H36N2O3 — CID 170149009
(2R)-2-[[5-methyl-4-[(2-methyl-3-phenylphenyl)methylamino]-2-phenylmethoxyphenyl]methylamino]but-3-ene-1,3-diol (PubChem CID 170149009) has the molecular formula C33H36N2O3 and a molecular weight of 508.66 g/mol. Its IUPAC name is (2R)-2-[[5-methyl-4-[(2-methyl-3-phenylphenyl)methylamino]-2-phenylmethoxyphenyl]methylamino]but-3-ene-1,3-diol.
| Compound Name | (2R)-2-[[5-methyl-4-[(2-methyl-3-phenylphenyl)methylamino]-2-phenylmethoxyphenyl]methylamino]but-3-ene-1,3-diol |
|---|---|
| PubChem CID | 170149009 |
| Molecular Formula | C33H36N2O3 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | (2R)-2-[[5-methyl-4-[(2-methyl-3-phenylphenyl)methylamino]-2-phenylmethoxyphenyl]methylamino]but-3-ene-1,3-diol |
| SMILES | C=C(O)[C@@H](CO)NCc1cc(C)c(NCc2cccc(-c3ccccc3)c2C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C33H36N2O3/c1-23-17-29(20-35-32(21-36)25(3)37)33(38-22-26-11-6-4-7-12-26)18-31(23)34-19-28-15-10-16-30(24(28)2)27-13-8-5-9-14-27/h4-18,32,34-37H,3,19-22H2,1-2H3/t32-/m1/s1 |
| InChIKey | CWUPTJUNLFQBDA-JGCGQSQUSA-N |
| XLogP | 6.68 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|