C30H29NO2 — CID 169075424
3,5-dimethyl-4-[(2-methyl-3-phenylphenyl)methylamino]-2-phenylmethoxybenzaldehyde (PubChem CID 169075424) has the molecular formula C30H29NO2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(2-methyl-3-phenylphenyl)methylamino]-2-phenylmethoxybenzaldehyde.
| Compound Name | 3,5-dimethyl-4-[(2-methyl-3-phenylphenyl)methylamino]-2-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 169075424 |
| Molecular Formula | C30H29NO2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 3,5-dimethyl-4-[(2-methyl-3-phenylphenyl)methylamino]-2-phenylmethoxybenzaldehyde |
| SMILES | Cc1cc(C=O)c(OCc2ccccc2)c(C)c1NCc1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C30H29NO2/c1-21-17-27(19-32)30(33-20-24-11-6-4-7-12-24)23(3)29(21)31-18-26-15-10-16-28(22(26)2)25-13-8-5-9-14-25/h4-17,19,31H,18,20H2,1-3H3 |
| InChIKey | PEKYCKLKJQTGDL-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|