C17H32O3 — CID 170150787
3,4-bis(2,2-dimethylbutyl)oxolane-3-carboxylic acid (PubChem CID 170150787) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is 3,4-bis(2,2-dimethylbutyl)oxolane-3-carboxylic acid.
| Compound Name | 3,4-bis(2,2-dimethylbutyl)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 170150787 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 3,4-bis(2,2-dimethylbutyl)oxolane-3-carboxylic acid |
| SMILES | CCC(C)(C)CC1COCC1(CC(C)(C)CC)C(=O)O |
| InChI | InChI=1S/C17H32O3/c1-7-15(3,4)9-13-10-20-12-17(13,14(18)19)11-16(5,6)8-2/h13H,7-12H2,1-6H3,(H,18,19) |
| InChIKey | VVTCUOYWAOTDBN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |