C13H18N4O5 — CID 170154877
(2R,5S)-4-(6-methoxy-3-nitro-2-pyridinyl)-2,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 170154877) has the molecular formula C13H18N4O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is (2R,5S)-4-(6-methoxy-3-nitro-2-pyridinyl)-2,5-dimethylpiperazine-1-carboxylic acid.
| Compound Name | (2R,5S)-4-(6-methoxy-3-nitro-2-pyridinyl)-2,5-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 170154877 |
| Molecular Formula | C13H18N4O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (2R,5S)-4-(6-methoxy-3-nitro-2-pyridinyl)-2,5-dimethylpiperazine-1-carboxylic acid |
| SMILES | COc1ccc([N+](=O)[O-])c(N2C[C@@H](C)N(C(=O)O)C[C@@H]2C)n1 |
| InChI | InChI=1S/C13H18N4O5/c1-8-7-16(13(18)19)9(2)6-15(8)12-10(17(20)21)4-5-11(14-12)22-3/h4-5,8-9H,6-7H2,1-3H3,(H,18,19)/t8-,9+/m0/s1 |
| InChIKey | GSRPELYQBOWEPM-DTWKUNHWSA-N |
| XLogP | 1.58 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|