C15H21N3O4 — CID 68593304
1-[(2R,5S)-4-(3-methoxy-4-nitrophenyl)-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 68593304) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-[(2R,5S)-4-(3-methoxy-4-nitrophenyl)-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 1-[(2R,5S)-4-(3-methoxy-4-nitrophenyl)-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 68593304 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-[(2R,5S)-4-(3-methoxy-4-nitrophenyl)-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | COc1cc(N2C[C@@H](C)N(C(C)=O)C[C@@H]2C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O4/c1-10-9-17(11(2)8-16(10)12(3)19)13-5-6-14(18(20)21)15(7-13)22-4/h5-7,10-11H,8-9H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | BKNPLRKXAKCLHY-MNOVXSKESA-N |
| XLogP | 2.05 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|