C13H17BrN4O — CID 170156214
5-bromo-N-[(3R)-1-ethylpiperidin-3-yl]-[1,3]oxazolo[4,5-b]pyridin-2-amine (PubChem CID 170156214) has the molecular formula C13H17BrN4O and a molecular weight of 325.21 g/mol. Its IUPAC name is 5-bromo-N-[(3R)-1-ethylpiperidin-3-yl]-[1,3]oxazolo[4,5-b]pyridin-2-amine.
| Compound Name | 5-bromo-N-[(3R)-1-ethylpiperidin-3-yl]-[1,3]oxazolo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 170156214 |
| Molecular Formula | C13H17BrN4O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 5-bromo-N-[(3R)-1-ethylpiperidin-3-yl]-[1,3]oxazolo[4,5-b]pyridin-2-amine |
| SMILES | CCN1CCC[C@@H](Nc2nc3nc(Br)ccc3o2)C1 |
| InChI | InChI=1S/C13H17BrN4O/c1-2-18-7-3-4-9(8-18)15-13-17-12-10(19-13)5-6-11(14)16-12/h5-6,9H,2-4,7-8H2,1H3,(H,15,16,17)/t9-/m1/s1 |
| InChIKey | JEXREUNBQHUVPH-SECBINFHSA-N |
| XLogP | 2.88 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|