C13H17ClN4O2 — CID 175586005
(3R)-5-[(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)amino]-1-ethylpiperidin-3-ol (PubChem CID 175586005) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is (3R)-5-[(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)amino]-1-ethylpiperidin-3-ol.
| Compound Name | (3R)-5-[(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)amino]-1-ethylpiperidin-3-ol |
|---|---|
| PubChem CID | 175586005 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (3R)-5-[(5-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)amino]-1-ethylpiperidin-3-ol |
| SMILES | CCN1CC(Nc2nc3nc(Cl)ccc3o2)C[C@@H](O)C1 |
| InChI | InChI=1S/C13H17ClN4O2/c1-2-18-6-8(5-9(19)7-18)15-13-17-12-10(20-13)3-4-11(14)16-12/h3-4,8-9,19H,2,5-7H2,1H3,(H,15,16,17)/t8?,9-/m1/s1 |
| InChIKey | PALCEVFGGCUIQD-YGPZHTELSA-N |
| XLogP | 1.74 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|