C11H13BrN4O — CID 171778054
5-bromo-N-[(3R)-piperidin-3-yl]-[1,3]oxazolo[4,5-b]pyridin-2-amine (PubChem CID 171778054) has the molecular formula C11H13BrN4O and a molecular weight of 297.16 g/mol. Its IUPAC name is 5-bromo-N-[(3R)-piperidin-3-yl]-[1,3]oxazolo[4,5-b]pyridin-2-amine.
| Compound Name | 5-bromo-N-[(3R)-piperidin-3-yl]-[1,3]oxazolo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 171778054 |
| Molecular Formula | C11H13BrN4O |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 5-bromo-N-[(3R)-piperidin-3-yl]-[1,3]oxazolo[4,5-b]pyridin-2-amine |
| SMILES | Brc1ccc2oc(N[C@@H]3CCCNC3)nc2n1 |
| InChI | InChI=1S/C11H13BrN4O/c12-9-4-3-8-10(15-9)16-11(17-8)14-7-2-1-5-13-6-7/h3-4,7,13H,1-2,5-6H2,(H,14,15,16)/t7-/m1/s1 |
| InChIKey | LWRMUJFREFWCRV-SSDOTTSWSA-N |
| XLogP | 2.15 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|