C20H20ClF3N6 — CID 170156456
N-[2-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-6-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 170156456) has the molecular formula C20H20ClF3N6 and a molecular weight of 436.87 g/mol. Its IUPAC name is N-[2-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-6-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[2-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-6-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170156456 |
| Molecular Formula | C20H20ClF3N6 |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[2-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2-chloro-6-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1cc(CCNc2nc(Cl)nc3cnc(N4CCCC4)cc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20ClF3N6/c21-19-28-16-11-27-17(30-5-1-2-6-30)10-15(16)18(29-19)26-4-3-12-7-13(20(22,23)24)9-14(25)8-12/h7-11H,1-6,25H2,(H,26,28,29) |
| InChIKey | MFSYSGHUUHYJMU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|