C24H28F3N7 — CID 170156133
N-[2-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2,6-dipyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 170156133) has the molecular formula C24H28F3N7 and a molecular weight of 471.53 g/mol. Its IUPAC name is N-[2-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2,6-dipyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[2-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2,6-dipyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170156133 |
| Molecular Formula | C24H28F3N7 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[2-[3-amino-5-(trifluoromethyl)phenyl]ethyl]-2,6-dipyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1cc(CCNc2nc(N3CCCC3)nc3cnc(N4CCCC4)cc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H28F3N7/c25-24(26,27)17-11-16(12-18(28)13-17)5-6-29-22-19-14-21(33-7-1-2-8-33)30-15-20(19)31-23(32-22)34-9-3-4-10-34/h11-15H,1-10,28H2,(H,29,31,32) |
| InChIKey | QVPLNXVPFCNSRP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|