C22H24F3N7O3 — CID 170156089
2-N,2-N-dimethyl-6-morpholin-4-yl-4-N-[2-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[3,4-d]pyrimidine-2,4-diamine (PubChem CID 170156089) has the molecular formula C22H24F3N7O3 and a molecular weight of 491.47 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-morpholin-4-yl-4-N-[2-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[3,4-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-morpholin-4-yl-4-N-[2-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[3,4-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 170156089 |
| Molecular Formula | C22H24F3N7O3 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-N,2-N-dimethyl-6-morpholin-4-yl-4-N-[2-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]pyrido[3,4-d]pyrimidine-2,4-diamine |
| SMILES | CN(C)c1nc(NCCc2cc([N+](=O)[O-])cc(C(F)(F)F)c2)c2cc(N3CCOCC3)ncc2n1 |
| InChI | InChI=1S/C22H24F3N7O3/c1-30(2)21-28-18-13-27-19(31-5-7-35-8-6-31)12-17(18)20(29-21)26-4-3-14-9-15(22(23,24)25)11-16(10-14)32(33)34/h9-13H,3-8H2,1-2H3,(H,26,28,29) |
| InChIKey | HXRILFOJOFCOTB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|